Products 2167657-40-9

CAS 2167657-40-9 is the registry number for 6-Thia-2-azaspiro[3.4]octane-8-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

6-thia-2-azaspiro[3.4]octane-8-carboxylic acid (CAS 2167657-40-9) is a chemical compound with the molecular formula C7H11NO2S and a molecular weight of 173.24 g/mol. IUPAC name: 6-thia-2-azaspiro[3.4]octane-8-carboxylic acid. InChIKey: FBIUMUGUIFYPGK-UHFFFAOYSA-N.

Identity
Molecular formulaC7H11NO2S
Molecular weight173.24 g/mol
IUPAC name6-thia-2-azaspiro[3.4]octane-8-carboxylic acid
InChIKeyFBIUMUGUIFYPGK-UHFFFAOYSA-N
SMILESC1C(C2(CNC2)CS1)C(=O)O

Computed by PubChem (NCBI)