Products 2167937-99-5

CAS 2167937-99-5 is the registry number for tert-Butyl 2-(iodomethyl)-5,5-dimethylmorpholine-4-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Tert-butyl 2-(iodomethyl)-5,5-dimethylmorpholine-4-carboxylate (CAS 2167937-99-5) is a chemical compound with the molecular formula C12H22INO3 and a molecular weight of 355.21 g/mol. IUPAC name: tert-butyl 2-(iodomethyl)-5,5-dimethylmorpholine-4-carboxylate. InChIKey: MSIRDOLZENEODO-UHFFFAOYSA-N.

Identity
Molecular formulaC12H22INO3
Molecular weight355.21 g/mol
IUPAC nametert-butyl 2-(iodomethyl)-5,5-dimethylmorpholine-4-carboxylate
InChIKeyMSIRDOLZENEODO-UHFFFAOYSA-N
SMILESCC1(COC(CN1C(=O)OC(C)(C)C)CI)C

Computed by PubChem (NCBI)