Products 2168-06-1

CAS 2168-06-1 is the registry number for 3,3,3-Tris(4-chlorophenyl)propionic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

3,3,3-tris(4-chlorophenyl)propanoic acid (CAS 2168-06-1) is a chemical compound with the molecular formula C21H15Cl3O2 and a molecular weight of 405.7 g/mol. IUPAC name: 3,3,3-tris(4-chlorophenyl)propanoic acid. InChIKey: LHIVWYJOCNGZRI-UHFFFAOYSA-N.

Identity
Molecular formulaC21H15Cl3O2
Molecular weight405.7 g/mol
IUPAC name3,3,3-tris(4-chlorophenyl)propanoic acid
InChIKeyLHIVWYJOCNGZRI-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C(CC(=O)O)(C2=CC=C(C=C2)Cl)C3=CC=C(C=C3)Cl)Cl

Computed by PubChem (NCBI)