CAS 2168-06-1 is the registry number for 3,3,3-Tris(4-chlorophenyl)propionic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
3,3,3-tris(4-chlorophenyl)propanoic acid (CAS 2168-06-1) is a chemical compound with the molecular formula C21H15Cl3O2 and a molecular weight of 405.7 g/mol. IUPAC name: 3,3,3-tris(4-chlorophenyl)propanoic acid. InChIKey: LHIVWYJOCNGZRI-UHFFFAOYSA-N.
| Molecular formula | C21H15Cl3O2 |
|---|---|
| Molecular weight | 405.7 g/mol |
| IUPAC name | 3,3,3-tris(4-chlorophenyl)propanoic acid |
| InChIKey | LHIVWYJOCNGZRI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(CC(=O)O)(C2=CC=C(C=C2)Cl)C3=CC=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)