CAS 2168110-26-5 is the registry number for 1-Bromo-4-fluoro-5-(methylthio)-2-(trifluoromethyl)benzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.
1-bromo-4-fluoro-5-methylsulfanyl-2-(trifluoromethyl)benzene (CAS 2168110-26-5) is a chemical compound with the molecular formula C8H5BrF4S and a molecular weight of 289.09 g/mol. IUPAC name: 1-bromo-4-fluoro-5-methylsulfanyl-2-(trifluoromethyl)benzene. InChIKey: UVYUOQASVGVNQZ-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF4S |
|---|---|
| Molecular weight | 289.09 g/mol |
| IUPAC name | 1-bromo-4-fluoro-5-methylsulfanyl-2-(trifluoromethyl)benzene |
| InChIKey | UVYUOQASVGVNQZ-UHFFFAOYSA-N |
| SMILES | CSC1=C(C=C(C(=C1)Br)C(F)(F)F)F |
Computed by PubChem (NCBI)