Products 2168126-53-0
CAS 2168126-53-0 is the registry number for tert-Butyl 3-amino-3-(3,5-difluorophenyl)azetidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3-amino-3-(3,5-difluorophenyl)azetidine-1-carboxylate (CAS 2168126-53-0) is a chemical compound with the molecular formula C14H18F2N2O2 and a molecular weight of 284.30 g/mol. IUPAC name: tert-butyl 3-amino-3-(3,5-difluorophenyl)azetidine-1-carboxylate. InChIKey: JXHOPGJWPXVMOE-UHFFFAOYSA-N.
| Molecular formula | C14H18F2N2O2 |
|---|---|
| Molecular weight | 284.30 g/mol |
| IUPAC name | tert-butyl 3-amino-3-(3,5-difluorophenyl)azetidine-1-carboxylate |
| InChIKey | JXHOPGJWPXVMOE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)(C2=CC(=CC(=C2)F)F)N |
Computed by PubChem (NCBI)