Products 2168345-49-9

CAS 2168345-49-9 is the registry number for 5,7-Dibromo-4-fluoro-1H-indole-2,3-dione, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

5,7-dibromo-4-fluoro-1H-indole-2,3-dione (CAS 2168345-49-9) is a chemical compound with the molecular formula C8H2Br2FNO2 and a molecular weight of 322.91 g/mol. IUPAC name: 5,7-dibromo-4-fluoro-1H-indole-2,3-dione. InChIKey: RFFFSZPWFNNYBM-UHFFFAOYSA-N.

Identity
Molecular formulaC8H2Br2FNO2
Molecular weight322.91 g/mol
IUPAC name5,7-dibromo-4-fluoro-1H-indole-2,3-dione
InChIKeyRFFFSZPWFNNYBM-UHFFFAOYSA-N
SMILESC1=C(C2=C(C(=C1Br)F)C(=O)C(=O)N2)Br

Computed by PubChem (NCBI)