CAS 2168345-49-9 is the registry number for 5,7-Dibromo-4-fluoro-1H-indole-2,3-dione, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
5,7-dibromo-4-fluoro-1H-indole-2,3-dione (CAS 2168345-49-9) is a chemical compound with the molecular formula C8H2Br2FNO2 and a molecular weight of 322.91 g/mol. IUPAC name: 5,7-dibromo-4-fluoro-1H-indole-2,3-dione. InChIKey: RFFFSZPWFNNYBM-UHFFFAOYSA-N.
| Molecular formula | C8H2Br2FNO2 |
|---|---|
| Molecular weight | 322.91 g/mol |
| IUPAC name | 5,7-dibromo-4-fluoro-1H-indole-2,3-dione |
| InChIKey | RFFFSZPWFNNYBM-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(C(=C1Br)F)C(=O)C(=O)N2)Br |
Computed by PubChem (NCBI)