CAS 2168525-92-4 appears in our catalog under these names: UT-34, 98%, UT–34, UT-34/ 98.1% (existing batch purity), UT-34 98%, (S)-N-(4-Cyano-3-(trifluoromethyl)phenyl)-3-(4-fluoro-1H-pyrazol-1-yl)-2-hydroxy-2-methylpropanamide, 98%, 98%. Offered by: AmBeed, GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 1g, 1mg, 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg, 2mg.
(2S)-N-[4-cyano-3-(trifluoromethyl)phenyl]-3-(4-fluoropyrazol-1-yl)-2-hydroxy-2-methylpropanamide (CAS 2168525-92-4) is a chemical compound with the molecular formula C15H12F4N4O2 and a molecular weight of 356.27 g/mol. IUPAC name: (2S)-N-[4-cyano-3-(trifluoromethyl)phenyl]-3-(4-fluoropyrazol-1-yl)-2-hydroxy-2-methylpropanamide. InChIKey: YDRMSDHDYRAUBR-AWEZNQCLSA-N.
| Molecular formula | C15H12F4N4O2 |
|---|---|
| Molecular weight | 356.27 g/mol |
| IUPAC name | (2S)-N-[4-cyano-3-(trifluoromethyl)phenyl]-3-(4-fluoropyrazol-1-yl)-2-hydroxy-2-methylpropanamide |
| InChIKey | YDRMSDHDYRAUBR-AWEZNQCLSA-N |
| SMILES | C[C@](CN1C=C(C=N1)F)(C(=O)NC2=CC(=C(C=C2)C#N)C(F)(F)F)O |
Computed by PubChem (NCBI)