Products 2168733-41-1
CAS 2168733-41-1 is the registry number for 5-Bromo-1,2-dichloro-3-(trifluoromethoxy)benzene, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-bromo-1,2-dichloro-3-(trifluoromethoxy)benzene (CAS 2168733-41-1) is a chemical compound with the molecular formula C7H2BrCl2F3O and a molecular weight of 309.89 g/mol. IUPAC name: 5-bromo-1,2-dichloro-3-(trifluoromethoxy)benzene. InChIKey: TZZQUEMYGAJHAV-UHFFFAOYSA-N.
| Molecular formula | C7H2BrCl2F3O |
|---|---|
| Molecular weight | 309.89 g/mol |
| IUPAC name | 5-bromo-1,2-dichloro-3-(trifluoromethoxy)benzene |
| InChIKey | TZZQUEMYGAJHAV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1OC(F)(F)F)Cl)Cl)Br |
Computed by PubChem (NCBI)