Products 2168779-27-7

CAS 2168779-27-7 is the registry number for 6,6-Difluoro-3-azabicyclo[3.1.0]hexane-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

6,6-difluoro-3-azabicyclo[3.1.0]hexane-2-carboxylic acid (CAS 2168779-27-7) is a chemical compound with the molecular formula C6H7F2NO2 and a molecular weight of 163.12 g/mol. IUPAC name: 6,6-difluoro-3-azabicyclo[3.1.0]hexane-2-carboxylic acid. InChIKey: XDUPUGVSNVSIEE-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7F2NO2
Molecular weight163.12 g/mol
IUPAC name6,6-difluoro-3-azabicyclo[3.1.0]hexane-2-carboxylic acid
InChIKeyXDUPUGVSNVSIEE-UHFFFAOYSA-N
SMILESC1C2C(C2(F)F)C(N1)C(=O)O

Computed by PubChem (NCBI)