Products 2168835-29-6

CAS 2168835-29-6 is the registry number for 2-(4-Fluorophenyl)-5,8-dioxaspiro[3.4]octane-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(4-fluorophenyl)-5,8-dioxaspiro[3.4]octane-2-carboxylic acid (CAS 2168835-29-6) is a chemical compound with the molecular formula C13H13FO4 and a molecular weight of 252.24 g/mol. IUPAC name: 2-(4-fluorophenyl)-5,8-dioxaspiro[3.4]octane-2-carboxylic acid. InChIKey: AHCACHXPXNHCKZ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H13FO4
Molecular weight252.24 g/mol
IUPAC name2-(4-fluorophenyl)-5,8-dioxaspiro[3.4]octane-2-carboxylic acid
InChIKeyAHCACHXPXNHCKZ-UHFFFAOYSA-N
SMILESC1COC2(O1)CC(C2)(C3=CC=C(C=C3)F)C(=O)O

Computed by PubChem (NCBI)