CAS 2168835-29-6 is the registry number for 2-(4-Fluorophenyl)-5,8-dioxaspiro[3.4]octane-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-fluorophenyl)-5,8-dioxaspiro[3.4]octane-2-carboxylic acid (CAS 2168835-29-6) is a chemical compound with the molecular formula C13H13FO4 and a molecular weight of 252.24 g/mol. IUPAC name: 2-(4-fluorophenyl)-5,8-dioxaspiro[3.4]octane-2-carboxylic acid. InChIKey: AHCACHXPXNHCKZ-UHFFFAOYSA-N.
| Molecular formula | C13H13FO4 |
|---|---|
| Molecular weight | 252.24 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-5,8-dioxaspiro[3.4]octane-2-carboxylic acid |
| InChIKey | AHCACHXPXNHCKZ-UHFFFAOYSA-N |
| SMILES | C1COC2(O1)CC(C2)(C3=CC=C(C=C3)F)C(=O)O |
Computed by PubChem (NCBI)