CAS 2168877-33-4 is the registry number for 3-Bromo-5-fluoro-4-nitropyridine 1-oxide 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
3-bromo-5-fluoro-4-nitro-1-oxidopyridin-1-ium (CAS 2168877-33-4) is a chemical compound with the molecular formula C5H2BrFN2O3 and a molecular weight of 236.98 g/mol. IUPAC name: 3-bromo-5-fluoro-4-nitro-1-oxidopyridin-1-ium. InChIKey: QQQIAVRCLPROBD-UHFFFAOYSA-N.
| Molecular formula | C5H2BrFN2O3 |
|---|---|
| Molecular weight | 236.98 g/mol |
| IUPAC name | 3-bromo-5-fluoro-4-nitro-1-oxidopyridin-1-ium |
| InChIKey | QQQIAVRCLPROBD-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C=[N+]1[O-])Br)[N+](=O)[O-])F |
Computed by PubChem (NCBI)