CAS 21691-53-2 is the registry number for (S)-tert-Butyl 2-amino-4-methylpentanoate, 97%. Offered by: AmBeed. Available pack sizes: 5g, 25g.
Tert-butyl (2S)-2-amino-4-methylpentanoate (CAS 21691-53-2) is a chemical compound with the molecular formula C10H21NO2 and a molecular weight of 187.28 g/mol. IUPAC name: tert-butyl (2S)-2-amino-4-methylpentanoate. InChIKey: HBEJJYHFTZDAHZ-QMMMGPOBSA-N.
| Molecular formula | C10H21NO2 |
|---|---|
| Molecular weight | 187.28 g/mol |
| IUPAC name | tert-butyl (2S)-2-amino-4-methylpentanoate |
| InChIKey | HBEJJYHFTZDAHZ-QMMMGPOBSA-N |
| SMILES | CC(C)C[C@@H](C(=O)OC(C)(C)C)N |
Computed by PubChem (NCBI)