CAS 2169271-17-2 is the registry number for JAK1-IN-19. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[(3R,4S)-4-cyanooxan-3-yl]-3-[4-(1-methylpyrazol-4-yl)anilino]pyrazole-4-carboxamide (CAS 2169271-17-2) is a chemical compound with the molecular formula C20H21N7O2 and a molecular weight of 391.4 g/mol. IUPAC name: 1-[(3R,4S)-4-cyanooxan-3-yl]-3-[4-(1-methylpyrazol-4-yl)anilino]pyrazole-4-carboxamide. InChIKey: YAHGUPVIQAEPKI-KDOFPFPSSA-N.
| Molecular formula | C20H21N7O2 |
|---|---|
| Molecular weight | 391.4 g/mol |
| IUPAC name | 1-[(3R,4S)-4-cyanooxan-3-yl]-3-[4-(1-methylpyrazol-4-yl)anilino]pyrazole-4-carboxamide |
| InChIKey | YAHGUPVIQAEPKI-KDOFPFPSSA-N |
| SMILES | CN1C=C(C=N1)C2=CC=C(C=C2)NC3=NN(C=C3C(=O)N)[C@H]4COCC[C@@H]4C#N |
Computed by PubChem (NCBI)