CAS 2169310-98-7 is the registry number for 1,2,3,9B-Tetrahydro-4,4-benzo[c]thieno[2,1-e]isothiazole-8-carbonitrile 4-oxide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-oxo-6lambda6-thia-7-azatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraene-11-carbonitrile (CAS 2169310-98-7) is a chemical compound with the molecular formula C11H10N2OS and a molecular weight of 218.28 g/mol. IUPAC name: 6-oxo-6lambda6-thia-7-azatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraene-11-carbonitrile. InChIKey: DODDSMNPOPGJFY-UHFFFAOYSA-N.
| Molecular formula | C11H10N2OS |
|---|---|
| Molecular weight | 218.28 g/mol |
| IUPAC name | 6-oxo-6lambda6-thia-7-azatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraene-11-carbonitrile |
| InChIKey | DODDSMNPOPGJFY-UHFFFAOYSA-N |
| SMILES | C1CC2C3=C(C=CC(=C3)C#N)N=S2(=O)C1 |
Computed by PubChem (NCBI)