CAS 2169316-15-6 appears in our catalog under these names: SOCE inhibitor 1, SOCE inhibitor 1, SOCE inhibitor 1, 99.73%, 99.73%, SOCE inhibitor 1, 99.73%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, 2mg, 25mg, 50mg, 1mg, 5mg, 10mM (in 1ml dmso), 10mg.
3-[1-[4-[4-pentan-2-yloxycarbonyl-5-(trifluoromethyl)pyrazol-1-yl]phenyl]triazol-4-yl]benzoic acid (CAS 2169316-15-6) is a chemical compound with the molecular formula C25H22F3N5O4 and a molecular weight of 513.5 g/mol. IUPAC name: 3-[1-[4-[4-pentan-2-yloxycarbonyl-5-(trifluoromethyl)pyrazol-1-yl]phenyl]triazol-4-yl]benzoic acid. InChIKey: ZAJXAJYMOCWUGX-UHFFFAOYSA-N.
| Molecular formula | C25H22F3N5O4 |
|---|---|
| Molecular weight | 513.5 g/mol |
| IUPAC name | 3-[1-[4-[4-pentan-2-yloxycarbonyl-5-(trifluoromethyl)pyrazol-1-yl]phenyl]triazol-4-yl]benzoic acid |
| InChIKey | ZAJXAJYMOCWUGX-UHFFFAOYSA-N |
| SMILES | CCCC(C)OC(=O)C1=C(N(N=C1)C2=CC=C(C=C2)N3C=C(N=N3)C4=CC(=CC=C4)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)