CAS 21695-33-0 appears in our catalog under these names: 2-(Carboxymethyl)-1,3-dioxoisoindoline-5-carboxylic acid, 95%, 2-(Carboxymethyl)-1,3-dioxoisoindoline-5-carboxylic acid 97%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 1g, 250mg, 50mg, 100mg.
2-(carboxymethyl)-1,3-dioxoisoindole-5-carboxylic acid (CAS 21695-33-0) is a chemical compound with the molecular formula C11H7NO6 and a molecular weight of 249.18 g/mol. IUPAC name: 2-(carboxymethyl)-1,3-dioxoisoindole-5-carboxylic acid. InChIKey: RPFFHROJAGNUIW-UHFFFAOYSA-N.
| Molecular formula | C11H7NO6 |
|---|---|
| Molecular weight | 249.18 g/mol |
| IUPAC name | 2-(carboxymethyl)-1,3-dioxoisoindole-5-carboxylic acid |
| InChIKey | RPFFHROJAGNUIW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)C(=O)N(C2=O)CC(=O)O |
Computed by PubChem (NCBI)