Products 2169562-63-2
CAS 2169562-63-2 appears in our catalog under these names: 2-Amino-5-fluoro-3-hydroxybenzoic acid, 97%, 2-Amino-5-fluoro-3-hydroxy-benzoic acid, 95%, 2-Amino-5-fluoro-3-hydroxybenzoic acid, 97%, 97%. Offered by: Fluorochem, Combi-blocks, Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-amino-5-fluoro-3-hydroxybenzoic acid (CAS 2169562-63-2) is a chemical compound with the molecular formula C7H6FNO3 and a molecular weight of 171.13 g/mol. IUPAC name: 2-amino-5-fluoro-3-hydroxybenzoic acid. InChIKey: YCGDTOGRPJWAFF-UHFFFAOYSA-N.
| Molecular formula | C7H6FNO3 |
|---|---|
| Molecular weight | 171.13 g/mol |
| IUPAC name | 2-amino-5-fluoro-3-hydroxybenzoic acid |
| InChIKey | YCGDTOGRPJWAFF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)N)O)F |
Computed by PubChem (NCBI)