CAS 2169906-37-8 is the registry number for 3-((1,1-Difluoro-2-hydroxyethyl)sulfonyl)phenol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(1,1-difluoro-2-hydroxyethyl)sulfonylphenol (CAS 2169906-37-8) is a chemical compound with the molecular formula C8H8F2O4S and a molecular weight of 238.21 g/mol. IUPAC name: 3-(1,1-difluoro-2-hydroxyethyl)sulfonylphenol. InChIKey: XFBOWJXENHBSBQ-UHFFFAOYSA-N.
| Molecular formula | C8H8F2O4S |
|---|---|
| Molecular weight | 238.21 g/mol |
| IUPAC name | 3-(1,1-difluoro-2-hydroxyethyl)sulfonylphenol |
| InChIKey | XFBOWJXENHBSBQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)C(CO)(F)F)O |
Computed by PubChem (NCBI)