CAS 2170451-00-8 is the registry number for 5-Bromo-4-methyl-1-(phenylsulfonyl)-1H-indole-2-carbonitrile, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-(benzenesulfonyl)-5-bromo-4-methylindole-2-carbonitrile (CAS 2170451-00-8) is a chemical compound with the molecular formula C16H11BrN2O2S and a molecular weight of 375.2 g/mol. IUPAC name: 1-(benzenesulfonyl)-5-bromo-4-methylindole-2-carbonitrile. InChIKey: VBVJJYVKJHNAIT-UHFFFAOYSA-N.
| Molecular formula | C16H11BrN2O2S |
|---|---|
| Molecular weight | 375.2 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-5-bromo-4-methylindole-2-carbonitrile |
| InChIKey | VBVJJYVKJHNAIT-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C1C=C(N2S(=O)(=O)C3=CC=CC=C3)C#N)Br |
Computed by PubChem (NCBI)