CAS 2170565-36-1 appears in our catalog under these names: 8-Boc-8-aza-bicyclo[3.2.1]oct-2-ene-3-boronicacid, 98%, 98%, (8-(tert-Butoxycarbonyl)-8-azabicyclo[3.2.1]oct-2-en-3-yl)boronic acid, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 250mg, 1g, 5g.
[8-[(2-methylpropan-2-yl)oxycarbonyl]-8-azabicyclo[3.2.1]oct-2-en-3-yl]boronic acid (CAS 2170565-36-1) is a chemical compound with the molecular formula C12H20BNO4 and a molecular weight of 253.10 g/mol. IUPAC name: [8-[(2-methylpropan-2-yl)oxycarbonyl]-8-azabicyclo[3.2.1]oct-2-en-3-yl]boronic acid. InChIKey: UPIWLOIVOXXOGF-UHFFFAOYSA-N.
| Molecular formula | C12H20BNO4 |
|---|---|
| Molecular weight | 253.10 g/mol |
| IUPAC name | [8-[(2-methylpropan-2-yl)oxycarbonyl]-8-azabicyclo[3.2.1]oct-2-en-3-yl]boronic acid |
| InChIKey | UPIWLOIVOXXOGF-UHFFFAOYSA-N |
| SMILES | B(C1=CC2CCC(C1)N2C(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)