CAS 2170798-10-2 is the registry number for 4-(4,6-Dimethoxy[1.3.5]triazin-2-yl)-4-methylmorpholinium chloride hydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 100g, 25g, 500g, 5g.
4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-4-methylmorpholin-4-ium;chloride;hydrate (CAS 2170798-10-2) is a chemical compound with the molecular formula C10H19ClN4O4 and a molecular weight of 294.73 g/mol. IUPAC name: 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-4-methylmorpholin-4-ium;chloride;hydrate. InChIKey: RJNUXEDAPIKMDE-UHFFFAOYSA-M.
| Molecular formula | C10H19ClN4O4 |
|---|---|
| Molecular weight | 294.73 g/mol |
| IUPAC name | 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-4-methylmorpholin-4-ium;chloride;hydrate |
| InChIKey | RJNUXEDAPIKMDE-UHFFFAOYSA-M |
| SMILES | C[N+]1(CCOCC1)C2=NC(=NC(=N2)OC)OC.O.[Cl-] |
Computed by PubChem (NCBI)