CAS 2170848-99-2 appears in our catalog under these names: QPX7728–OH disodium, Xeruborbactam disodium, 99.85%, 99.85%, Xeruborbactam (disodium), 99.92%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 1mg, 5 mg, 10mM/1mL, 1 mg.
Disodium;(2S,4R)-9-fluoro-5,5-dihydroxy-6-oxa-5-boranuidatricyclo[5.4.0.02,4]undeca-1(7),8,10-triene-8-carboxylate (CAS 2170848-99-2) is a chemical compound with the molecular formula C10H8BFNa2O5 and a molecular weight of 283.96 g/mol. IUPAC name: disodium;(2S,4R)-9-fluoro-5,5-dihydroxy-6-oxa-5-boranuidatricyclo[5.4.0.02,4]undeca-1(7),8,10-triene-8-carboxylate. InChIKey: RLVWXGRGTAHSCI-BNTLRKBRSA-M.
| Molecular formula | C10H8BFNa2O5 |
|---|---|
| Molecular weight | 283.96 g/mol |
| IUPAC name | disodium;(2S,4R)-9-fluoro-5,5-dihydroxy-6-oxa-5-boranuidatricyclo[5.4.0.02,4]undeca-1(7),8,10-triene-8-carboxylate |
| InChIKey | RLVWXGRGTAHSCI-BNTLRKBRSA-M |
| SMILES | [B-]1([C@@H]2C[C@@H]2C3=C(O1)C(=C(C=C3)F)C(=O)[O-])(O)O.[Na+].[Na+] |
Computed by PubChem (NCBI)