CAS 21709-40-0 is the registry number for 2-Amino-n,n,4-trimethyl-1,3-thiazole-5-carboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2-amino-N,N,4-trimethyl-1,3-thiazole-5-carboxamide (CAS 21709-40-0) is a chemical compound with the molecular formula C7H11N3OS and a molecular weight of 185.25 g/mol. IUPAC name: 2-amino-N,N,4-trimethyl-1,3-thiazole-5-carboxamide. InChIKey: DVJPMCANMMJVQH-UHFFFAOYSA-N.
| Molecular formula | C7H11N3OS |
|---|---|
| Molecular weight | 185.25 g/mol |
| IUPAC name | 2-amino-N,N,4-trimethyl-1,3-thiazole-5-carboxamide |
| InChIKey | DVJPMCANMMJVQH-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)N)C(=O)N(C)C |
Computed by PubChem (NCBI)