Products 2170995-70-5

CAS 2170995-70-5 is the registry number for rel-(1R,2R)-2-(Pyrimidin-5-yl)cyclopropane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Trans-(1R,2R)-2-pyrimidin-5-ylcyclopropane-1-carboxylic acid (CAS 2170995-70-5) is a chemical compound with the molecular formula C8H8N2O2 and a molecular weight of 164.16 g/mol. IUPAC name: trans-(1R,2R)-2-pyrimidin-5-ylcyclopropane-1-carboxylic acid. InChIKey: OTZPGMGFSWZANJ-NKWVEPMBSA-N.

Identity
Molecular formulaC8H8N2O2
Molecular weight164.16 g/mol
IUPAC nametrans-(1R,2R)-2-pyrimidin-5-ylcyclopropane-1-carboxylic acid
InChIKeyOTZPGMGFSWZANJ-NKWVEPMBSA-N
SMILESC1[C@H]([C@@H]1C(=O)O)C2=CN=CN=C2

Computed by PubChem (NCBI)