CAS 2170995-70-5 is the registry number for rel-(1R,2R)-2-(Pyrimidin-5-yl)cyclopropane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-(1R,2R)-2-pyrimidin-5-ylcyclopropane-1-carboxylic acid (CAS 2170995-70-5) is a chemical compound with the molecular formula C8H8N2O2 and a molecular weight of 164.16 g/mol. IUPAC name: trans-(1R,2R)-2-pyrimidin-5-ylcyclopropane-1-carboxylic acid. InChIKey: OTZPGMGFSWZANJ-NKWVEPMBSA-N.
| Molecular formula | C8H8N2O2 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | trans-(1R,2R)-2-pyrimidin-5-ylcyclopropane-1-carboxylic acid |
| InChIKey | OTZPGMGFSWZANJ-NKWVEPMBSA-N |
| SMILES | C1[C@H]([C@@H]1C(=O)O)C2=CN=CN=C2 |
Computed by PubChem (NCBI)