Products 2171273-02-0
CAS 2171273-02-0 is the registry number for 1-{((2S,4R)-4-Methoxypyrrolidin-2-yl)methyl}-1H-pyrazol-3-amine dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-[[(2S,4R)-4-methoxypyrrolidin-2-yl]methyl]pyrazol-3-amine;dihydrochloride (CAS 2171273-02-0) is a chemical compound with the molecular formula C9H18Cl2N4O and a molecular weight of 269.17 g/mol. IUPAC name: 1-[[(2S,4R)-4-methoxypyrrolidin-2-yl]methyl]pyrazol-3-amine;dihydrochloride. InChIKey: CZPCWTRFWKWNPW-OXOJUWDDSA-N.
| Molecular formula | C9H18Cl2N4O |
|---|---|
| Molecular weight | 269.17 g/mol |
| IUPAC name | 1-[[(2S,4R)-4-methoxypyrrolidin-2-yl]methyl]pyrazol-3-amine;dihydrochloride |
| InChIKey | CZPCWTRFWKWNPW-OXOJUWDDSA-N |
| SMILES | CO[C@@H]1C[C@H](NC1)CN2C=CC(=N2)N.Cl.Cl |
Computed by PubChem (NCBI)