CAS 2171282-19-0 appears in our catalog under these names: Fmoc-β-Ala-Phe-OH, Fmoc-β-Ala-Phe-OH 98%, (3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)propanoyl)-L-phenylalanine, 98%, 98%, Fmoc-L-β-Ala-Phe-OH, 98%. Offered by: Chemat Brand, Ambeed, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g, 5g, 50mg.
(2S)-2-[3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoylamino]-3-phenylpropanoic acid (CAS 2171282-19-0) is a chemical compound with the molecular formula C27H26N2O5 and a molecular weight of 458.5 g/mol. IUPAC name: (2S)-2-[3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoylamino]-3-phenylpropanoic acid. InChIKey: MOFPWDCXZWQZDZ-DEOSSOPVSA-N.
| Molecular formula | C27H26N2O5 |
|---|---|
| Molecular weight | 458.5 g/mol |
| IUPAC name | (2S)-2-[3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoylamino]-3-phenylpropanoic acid |
| InChIKey | MOFPWDCXZWQZDZ-DEOSSOPVSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)CCNC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)