CAS 217186-17-9 is the registry number for 2-(4-Trifluoromethylphenoxy)-5-nitrobenzaldehyde. Offered by: Biosynth. Available pack sizes: 100g, 50g.
5-nitro-2-[4-(trifluoromethyl)phenoxy]benzaldehyde (CAS 217186-17-9) is a chemical compound with the molecular formula C14H8F3NO4 and a molecular weight of 311.21 g/mol. IUPAC name: 5-nitro-2-[4-(trifluoromethyl)phenoxy]benzaldehyde. InChIKey: XKPAMQPTGFMKOV-UHFFFAOYSA-N.
| Molecular formula | C14H8F3NO4 |
|---|---|
| Molecular weight | 311.21 g/mol |
| IUPAC name | 5-nitro-2-[4-(trifluoromethyl)phenoxy]benzaldehyde |
| InChIKey | XKPAMQPTGFMKOV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(F)(F)F)OC2=C(C=C(C=C2)[N+](=O)[O-])C=O |
Computed by PubChem (NCBI)