CAS 2171901-41-8 is the registry number for 6-(tert-butoxy)pyridine-2-sulfinate lithium. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Lithium 6-[(2-methylpropan-2-yl)oxy]pyridine-2-sulfinate (CAS 2171901-41-8) is a chemical compound with the molecular formula C9H12LiNO3S and a molecular weight of 221.2 g/mol. IUPAC name: lithium 6-[(2-methylpropan-2-yl)oxy]pyridine-2-sulfinate. InChIKey: RNDIQDURLSVHFT-UHFFFAOYSA-M.
| Molecular formula | C9H12LiNO3S |
|---|---|
| Molecular weight | 221.2 g/mol |
| IUPAC name | lithium 6-[(2-methylpropan-2-yl)oxy]pyridine-2-sulfinate |
| InChIKey | RNDIQDURLSVHFT-UHFFFAOYSA-M |
| SMILES | [Li+].CC(C)(C)OC1=NC(=CC=C1)S(=O)[O-] |
Computed by PubChem (NCBI)