Products 217196-31-1

CAS 217196-31-1 is the registry number for 4-(5-Fluoro-2-methoxyphenyl)-4-methyl-2-oxopentanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-(5-fluoro-2-methoxyphenyl)-4-methyl-2-oxopentanoic acid (CAS 217196-31-1) is a chemical compound with the molecular formula C13H15FO4 and a molecular weight of 254.25 g/mol. IUPAC name: 4-(5-fluoro-2-methoxyphenyl)-4-methyl-2-oxopentanoic acid. InChIKey: FRUVVVPJVUXQTL-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15FO4
Molecular weight254.25 g/mol
IUPAC name4-(5-fluoro-2-methoxyphenyl)-4-methyl-2-oxopentanoic acid
InChIKeyFRUVVVPJVUXQTL-UHFFFAOYSA-N
SMILESCC(C)(CC(=O)C(=O)O)C1=C(C=CC(=C1)F)OC

Computed by PubChem (NCBI)