CAS 2172018-86-7 is the registry number for Sodium 2-oxo-octahydro-1H-indole-6-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Sodium 2-oxo-1,3,3a,4,5,6,7,7a-octahydroindole-6-carboxylate (CAS 2172018-86-7) is a chemical compound with the molecular formula C9H12NNaO3 and a molecular weight of 205.19 g/mol. IUPAC name: sodium 2-oxo-1,3,3a,4,5,6,7,7a-octahydroindole-6-carboxylate. InChIKey: PSJGMTARGVCTFS-UHFFFAOYSA-M.
| Molecular formula | C9H12NNaO3 |
|---|---|
| Molecular weight | 205.19 g/mol |
| IUPAC name | sodium 2-oxo-1,3,3a,4,5,6,7,7a-octahydroindole-6-carboxylate |
| InChIKey | PSJGMTARGVCTFS-UHFFFAOYSA-M |
| SMILES | C1CC2CC(=O)NC2CC1C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)