Products 2172260-06-7

CAS 2172260-06-7 is the registry number for Ethyl 4H-1,2,4-triazole-3-carboximidate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Ethyl 1H-1,2,4-triazole-5-carboximidate;hydrochloride (CAS 2172260-06-7) is a chemical compound with the molecular formula C5H9ClN4O and a molecular weight of 176.60 g/mol. IUPAC name: ethyl 1H-1,2,4-triazole-5-carboximidate;hydrochloride. InChIKey: QUHRNZOUYKUBQG-UHFFFAOYSA-N.

Identity
Molecular formulaC5H9ClN4O
Molecular weight176.60 g/mol
IUPAC nameethyl 1H-1,2,4-triazole-5-carboximidate;hydrochloride
InChIKeyQUHRNZOUYKUBQG-UHFFFAOYSA-N
SMILESCCOC(=N)C1=NC=NN1.Cl

Computed by PubChem (NCBI)