CAS 2172482-77-6 is the registry number for 1-tert-butyl-1H-pyrazole-4-sulfinate lithium. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Lithium 1-tert-butylpyrazole-4-sulfinate (CAS 2172482-77-6) is a chemical compound with the molecular formula C7H11LiN2O2S and a molecular weight of 194.2 g/mol. IUPAC name: lithium 1-tert-butylpyrazole-4-sulfinate. InChIKey: XMNGHKJYCORPNV-UHFFFAOYSA-M.
| Molecular formula | C7H11LiN2O2S |
|---|---|
| Molecular weight | 194.2 g/mol |
| IUPAC name | lithium 1-tert-butylpyrazole-4-sulfinate |
| InChIKey | XMNGHKJYCORPNV-UHFFFAOYSA-M |
| SMILES | [Li+].CC(C)(C)N1C=C(C=N1)S(=O)[O-] |
Computed by PubChem (NCBI)