CAS 2172495-41-7 is the registry number for 2-methyl-2H-1,2,3,4-tetrazole-5-sulfinate lithium. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Lithium 2-methyltetrazole-5-sulfinate (CAS 2172495-41-7) is a chemical compound with the molecular formula C2H3LiN4O2S and a molecular weight of 154.1 g/mol. IUPAC name: lithium 2-methyltetrazole-5-sulfinate. InChIKey: MPXBSTGKCAERLE-UHFFFAOYSA-M.
| Molecular formula | C2H3LiN4O2S |
|---|---|
| Molecular weight | 154.1 g/mol |
| IUPAC name | lithium 2-methyltetrazole-5-sulfinate |
| InChIKey | MPXBSTGKCAERLE-UHFFFAOYSA-M |
| SMILES | [Li+].CN1N=C(N=N1)S(=O)[O-] |
Computed by PubChem (NCBI)