CAS 2172495-64-4 is the registry number for 1-(1,2,3,4-Tetrahydronaphthalen-1-yl)cyclopropan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(1,2,3,4-tetrahydronaphthalen-1-yl)cyclopropan-1-amine;hydrochloride (CAS 2172495-64-4) is a chemical compound with the molecular formula C13H18ClN and a molecular weight of 223.74 g/mol. IUPAC name: 1-(1,2,3,4-tetrahydronaphthalen-1-yl)cyclopropan-1-amine;hydrochloride. InChIKey: FZAIGVIFNMKPLF-UHFFFAOYSA-N.
| Molecular formula | C13H18ClN |
|---|---|
| Molecular weight | 223.74 g/mol |
| IUPAC name | 1-(1,2,3,4-tetrahydronaphthalen-1-yl)cyclopropan-1-amine;hydrochloride |
| InChIKey | FZAIGVIFNMKPLF-UHFFFAOYSA-N |
| SMILES | C1CC(C2=CC=CC=C2C1)C3(CC3)N.Cl |
Computed by PubChem (NCBI)