CAS 2172503-72-7 is the registry number for 3-(4-Aminopiperidin-1-yl)-1H-1,2,4-triazol-5-ol dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(4-aminopiperidin-1-yl)-1,4-dihydro-1,2,4-triazol-5-one;dihydrochloride (CAS 2172503-72-7) is a chemical compound with the molecular formula C7H15Cl2N5O and a molecular weight of 256.13 g/mol. IUPAC name: 3-(4-aminopiperidin-1-yl)-1,4-dihydro-1,2,4-triazol-5-one;dihydrochloride. InChIKey: BNNATPUZTPHDNH-UHFFFAOYSA-N.
| Molecular formula | C7H15Cl2N5O |
|---|---|
| Molecular weight | 256.13 g/mol |
| IUPAC name | 3-(4-aminopiperidin-1-yl)-1,4-dihydro-1,2,4-triazol-5-one;dihydrochloride |
| InChIKey | BNNATPUZTPHDNH-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1N)C2=NNC(=O)N2.Cl.Cl |
Computed by PubChem (NCBI)