Products 2172547-51-0

CAS 2172547-51-0 is the registry number for tert-Butyl N-(5,5-dimethyl-1-oxohexan-3-yl)carbamate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Tert-butyl N-(5,5-dimethyl-1-oxohexan-3-yl)carbamate (CAS 2172547-51-0) is a chemical compound with the molecular formula C13H25NO3 and a molecular weight of 243.34 g/mol. IUPAC name: tert-butyl N-(5,5-dimethyl-1-oxohexan-3-yl)carbamate. InChIKey: ASVYJCJXBYNYKQ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H25NO3
Molecular weight243.34 g/mol
IUPAC nametert-butyl N-(5,5-dimethyl-1-oxohexan-3-yl)carbamate
InChIKeyASVYJCJXBYNYKQ-UHFFFAOYSA-N
SMILESCC(C)(C)CC(CC=O)NC(=O)OC(C)(C)C

Computed by PubChem (NCBI)