Products 2172553-68-1
CAS 2172553-68-1 is the registry number for 3-((4-{((9H-Fluoren-9-yl)methoxy)carbonyl}piperazin-1-yl)sulfonyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-[4-(9H-fluoren-9-ylmethoxycarbonyl)piperazin-1-yl]sulfonylbenzoic acid (CAS 2172553-68-1) is a chemical compound with the molecular formula C26H24N2O6S and a molecular weight of 492.5 g/mol. IUPAC name: 3-[4-(9H-fluoren-9-ylmethoxycarbonyl)piperazin-1-yl]sulfonylbenzoic acid. InChIKey: JMJNJTFJDUCRNL-UHFFFAOYSA-N.
| Molecular formula | C26H24N2O6S |
|---|---|
| Molecular weight | 492.5 g/mol |
| IUPAC name | 3-[4-(9H-fluoren-9-ylmethoxycarbonyl)piperazin-1-yl]sulfonylbenzoic acid |
| InChIKey | JMJNJTFJDUCRNL-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)S(=O)(=O)C5=CC=CC(=C5)C(=O)O |
Computed by PubChem (NCBI)