Products 2172567-04-1
CAS 2172567-04-1 is the registry number for (6,6-Dimethyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)methanol hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(6,6-dimethyl-5,7-dihydro-4H-1,3-benzothiazol-2-yl)methanol;hydrochloride (CAS 2172567-04-1) is a chemical compound with the molecular formula C10H16ClNOS and a molecular weight of 233.76 g/mol. IUPAC name: (6,6-dimethyl-5,7-dihydro-4H-1,3-benzothiazol-2-yl)methanol;hydrochloride. InChIKey: YIVZIDUMLXCQPQ-UHFFFAOYSA-N.
| Molecular formula | C10H16ClNOS |
|---|---|
| Molecular weight | 233.76 g/mol |
| IUPAC name | (6,6-dimethyl-5,7-dihydro-4H-1,3-benzothiazol-2-yl)methanol;hydrochloride |
| InChIKey | YIVZIDUMLXCQPQ-UHFFFAOYSA-N |
| SMILES | CC1(CCC2=C(C1)SC(=N2)CO)C.Cl |
Computed by PubChem (NCBI)