CAS 2172601-64-6 is the registry number for 3-(Bromomethyl)-5-tert-butylpyridine hydrobromide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(bromomethyl)-5-tert-butylpyridine;hydrobromide (CAS 2172601-64-6) is a chemical compound with the molecular formula C10H15Br2N and a molecular weight of 309.04 g/mol. IUPAC name: 3-(bromomethyl)-5-tert-butylpyridine;hydrobromide. InChIKey: OUAPSKWICMVVAY-UHFFFAOYSA-N.
| Molecular formula | C10H15Br2N |
|---|---|
| Molecular weight | 309.04 g/mol |
| IUPAC name | 3-(bromomethyl)-5-tert-butylpyridine;hydrobromide |
| InChIKey | OUAPSKWICMVVAY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CN=CC(=C1)CBr.Br |
Computed by PubChem (NCBI)