Products 2172940-51-9
CAS 2172940-51-9 is the registry number for N-(4-Nitrophenyl)-2-(phenylmethoxy)-N-(2-(phenylmethoxy)ethyl)-acetamide. Offered by: TRC. Available pack sizes: 5g.
N-(4-nitrophenyl)-2-phenylmethoxy-N-(2-phenylmethoxyethyl)acetamide (CAS 2172940-51-9) is a chemical compound with the molecular formula C24H24N2O5 and a molecular weight of 420.5 g/mol. IUPAC name: N-(4-nitrophenyl)-2-phenylmethoxy-N-(2-phenylmethoxyethyl)acetamide. InChIKey: OPHWECYDLCGTCJ-UHFFFAOYSA-N.
| Molecular formula | C24H24N2O5 |
|---|---|
| Molecular weight | 420.5 g/mol |
| IUPAC name | N-(4-nitrophenyl)-2-phenylmethoxy-N-(2-phenylmethoxyethyl)acetamide |
| InChIKey | OPHWECYDLCGTCJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COCCN(C2=CC=C(C=C2)[N+](=O)[O-])C(=O)COCC3=CC=CC=C3 |
Computed by PubChem (NCBI)