CAS 113108-86-4 appears in our catalog under these names: 9-(Benzylamino)-1,2,3,4-tetrahydroacridin-1-ol maleate, 97%, 9-(Benzylamino)-1,2,3,4-tetrahydroacridin-1-ol Maleate, >95% (HPLC), 9-(Benzylamino)-1,2,3,4-tetrahydroacridin-1-ol maleate. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 250mg, 500mg, 50mg.
9-(benzylamino)-1,2,3,4-tetrahydroacridin-1-ol;(Z)-but-2-enedioic acid (CAS 113108-86-4) is a chemical compound with the molecular formula C24H24N2O5 and a molecular weight of 420.5 g/mol. IUPAC name: 9-(benzylamino)-1,2,3,4-tetrahydroacridin-1-ol;(Z)-but-2-enedioic acid. InChIKey: JRQSVNSUJOFXHC-BTJKTKAUSA-N.
| Molecular formula | C24H24N2O5 |
|---|---|
| Molecular weight | 420.5 g/mol |
| IUPAC name | 9-(benzylamino)-1,2,3,4-tetrahydroacridin-1-ol;(Z)-but-2-enedioic acid |
| InChIKey | JRQSVNSUJOFXHC-BTJKTKAUSA-N |
| SMILES | C1CC(C2=C(C3=CC=CC=C3N=C2C1)NCC4=CC=CC=C4)O.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)