CAS 2172942-17-3 is the registry number for (S)-2,5-Dimethyl-3-((3-methylpiperazin-1-yl)methyl)aniline dihydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,5-dimethyl-3-[[(3S)-3-methylpiperazin-1-yl]methyl]aniline;dihydrochloride (CAS 2172942-17-3) is a chemical compound with the molecular formula C14H25Cl2N3 and a molecular weight of 306.3 g/mol. IUPAC name: 2,5-dimethyl-3-[[(3S)-3-methylpiperazin-1-yl]methyl]aniline;dihydrochloride. InChIKey: LTGSBFJVDJCZBP-IDMXKUIJSA-N.
| Molecular formula | C14H25Cl2N3 |
|---|---|
| Molecular weight | 306.3 g/mol |
| IUPAC name | 2,5-dimethyl-3-[[(3S)-3-methylpiperazin-1-yl]methyl]aniline;dihydrochloride |
| InChIKey | LTGSBFJVDJCZBP-IDMXKUIJSA-N |
| SMILES | C[C@H]1CN(CCN1)CC2=C(C(=CC(=C2)C)N)C.Cl.Cl |
Computed by PubChem (NCBI)