CAS 2173068-99-8 is the registry number for 2-Bromo-6-fluoro-5-methoxy-thiazolo[5,4-b]pyridine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-6-fluoro-5-methoxy-[1,3]thiazolo[5,4-b]pyridine (CAS 2173068-99-8) is a chemical compound with the molecular formula C7H4BrFN2OS and a molecular weight of 263.09 g/mol. IUPAC name: 2-bromo-6-fluoro-5-methoxy-[1,3]thiazolo[5,4-b]pyridine. InChIKey: CDBOODRFLFYLSV-UHFFFAOYSA-N.
| Molecular formula | C7H4BrFN2OS |
|---|---|
| Molecular weight | 263.09 g/mol |
| IUPAC name | 2-bromo-6-fluoro-5-methoxy-[1,3]thiazolo[5,4-b]pyridine |
| InChIKey | CDBOODRFLFYLSV-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=N1)SC(=N2)Br)F |
Computed by PubChem (NCBI)