CAS 2173074-75-2 is the registry number for 2-Bromo-5-fluoro-6-methoxybenzo[d]thiazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-5-fluoro-6-methoxy-1,3-benzothiazole (CAS 2173074-75-2) is a chemical compound with the molecular formula C8H5BrFNOS and a molecular weight of 262.10 g/mol. IUPAC name: 2-bromo-5-fluoro-6-methoxy-1,3-benzothiazole. InChIKey: GVOZAWDLXOFHJQ-UHFFFAOYSA-N.
| Molecular formula | C8H5BrFNOS |
|---|---|
| Molecular weight | 262.10 g/mol |
| IUPAC name | 2-bromo-5-fluoro-6-methoxy-1,3-benzothiazole |
| InChIKey | GVOZAWDLXOFHJQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)SC(=N2)Br)F |
Computed by PubChem (NCBI)