CAS 217309-83-6 appears in our catalog under these names: Poly((9,9-dihexylfluorenyl-2,7-diyl)-alt-(9,9'-spirobifluorene-2,7-diyl)), 1–Naphthylmethylammonium Bromide, 1-Naphthalenemethanamine hydrobromide, 99%+, 99%+. Offered by: Lumtec, GLPBio, Chemat. Available pack sizes: On request, 1g, 100mg, 250mg.
Naphthalen-1-ylmethanamine;hydrobromide (CAS 217309-83-6) is a chemical compound with the molecular formula C11H12BrN and a molecular weight of 238.12 g/mol. IUPAC name: naphthalen-1-ylmethanamine;hydrobromide. InChIKey: PCMACBQOVLUODT-UHFFFAOYSA-N.
| Molecular formula | C11H12BrN |
|---|---|
| Molecular weight | 238.12 g/mol |
| IUPAC name | naphthalen-1-ylmethanamine;hydrobromide |
| InChIKey | PCMACBQOVLUODT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2CN.Br |
Computed by PubChem (NCBI)