CAS 2173090-18-9 appears in our catalog under these names: (3-Methoxyazetidin-3-yl)methanamine bis(trifluoroacetic acid), 95%, (3-methoxyazetidin-3-yl)methanamine, bis(trifluoroacetic acid), 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g.
(3-methoxyazetidin-3-yl)methanamine;bis(2,2,2-trifluoroacetic acid) (CAS 2173090-18-9) is a chemical compound with the molecular formula C9H14F6N2O5 and a molecular weight of 344.21 g/mol. IUPAC name: (3-methoxyazetidin-3-yl)methanamine;bis(2,2,2-trifluoroacetic acid). InChIKey: FZAVXCXWUPBVPP-UHFFFAOYSA-N.
| Molecular formula | C9H14F6N2O5 |
|---|---|
| Molecular weight | 344.21 g/mol |
| IUPAC name | (3-methoxyazetidin-3-yl)methanamine;bis(2,2,2-trifluoroacetic acid) |
| InChIKey | FZAVXCXWUPBVPP-UHFFFAOYSA-N |
| SMILES | COC1(CNC1)CN.C(=O)(C(F)(F)F)O.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)