CAS 2173101-21-6 is the registry number for Sodium (2-chloro-4-sulfophenoxy)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Sodium 2-(2-chloro-4-sulfophenoxy)acetate (CAS 2173101-21-6) is a chemical compound with the molecular formula C8H6ClNaO6S and a molecular weight of 288.64 g/mol. IUPAC name: sodium 2-(2-chloro-4-sulfophenoxy)acetate. InChIKey: ZXDWEJNTRQUKEO-UHFFFAOYSA-M.
| Molecular formula | C8H6ClNaO6S |
|---|---|
| Molecular weight | 288.64 g/mol |
| IUPAC name | sodium 2-(2-chloro-4-sulfophenoxy)acetate |
| InChIKey | ZXDWEJNTRQUKEO-UHFFFAOYSA-M |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)O)Cl)OCC(=O)[O-].[Na+] |
Computed by PubChem (NCBI)