Products 2173116-42-0
CAS 2173116-42-0 is the registry number for 2,2-Difluoro-1-(4-methoxy-3-(trifluoromethyl)phenyl)ethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
2,2-difluoro-1-[4-methoxy-3-(trifluoromethyl)phenyl]ethanone (CAS 2173116-42-0) is a chemical compound with the molecular formula C10H7F5O2 and a molecular weight of 254.15 g/mol. IUPAC name: 2,2-difluoro-1-[4-methoxy-3-(trifluoromethyl)phenyl]ethanone. InChIKey: CLWFEADWJHPSTD-UHFFFAOYSA-N.
| Molecular formula | C10H7F5O2 |
|---|---|
| Molecular weight | 254.15 g/mol |
| IUPAC name | 2,2-difluoro-1-[4-methoxy-3-(trifluoromethyl)phenyl]ethanone |
| InChIKey | CLWFEADWJHPSTD-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)C(F)F)C(F)(F)F |
Computed by PubChem (NCBI)