CAS 2173116-45-3 is the registry number for 4-Amino-1,3,7-trimethyl-1,6,7,8-tetrahydro-5h-pyrazolo[3,4-b]quinolin-5-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-amino-1,3,7-trimethyl-7,8-dihydro-6H-pyrazolo[3,4-b]quinolin-5-one (CAS 2173116-45-3) is a chemical compound with the molecular formula C13H16N4O and a molecular weight of 244.29 g/mol. IUPAC name: 4-amino-1,3,7-trimethyl-7,8-dihydro-6H-pyrazolo[3,4-b]quinolin-5-one. InChIKey: RMMNECGNXUSIAN-UHFFFAOYSA-N.
| Molecular formula | C13H16N4O |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | 4-amino-1,3,7-trimethyl-7,8-dihydro-6H-pyrazolo[3,4-b]quinolin-5-one |
| InChIKey | RMMNECGNXUSIAN-UHFFFAOYSA-N |
| SMILES | CC1CC2=C(C(=O)C1)C(=C3C(=NN(C3=N2)C)C)N |
Computed by PubChem (NCBI)