Products 2173193-76-3
CAS 2173193-76-3 is the registry number for tert-Butyl (S)-(1-benzyl-5,5-dimethylpiperidin-3-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(3S)-1-benzyl-5,5-dimethylpiperidin-3-yl]carbamate (CAS 2173193-76-3) is a chemical compound with the molecular formula C19H30N2O2 and a molecular weight of 318.5 g/mol. IUPAC name: tert-butyl N-[(3S)-1-benzyl-5,5-dimethylpiperidin-3-yl]carbamate. InChIKey: XEHQLBKKBOGZFB-INIZCTEOSA-N.
| Molecular formula | C19H30N2O2 |
|---|---|
| Molecular weight | 318.5 g/mol |
| IUPAC name | tert-butyl N-[(3S)-1-benzyl-5,5-dimethylpiperidin-3-yl]carbamate |
| InChIKey | XEHQLBKKBOGZFB-INIZCTEOSA-N |
| SMILES | CC1(C[C@@H](CN(C1)CC2=CC=CC=C2)NC(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)